About 2-bromo-3-chloropropanal
2-bromo-3-chloropropanal (PubChem CID 12688066) has the molecular formula C3H4BrClO
and a molecular weight of 171.42 g/mol. Its IUPAC name is 2-bromo-3-chloropropanal.
Molecular Properties
| Compound Name | 2-bromo-3-chloropropanal |
| PubChem CID | 12688066 |
| Molecular Formula | C3H4BrClO |
| Molecular Weight | 171.42 g/mol |
| Exact Mass | 169.91 |
| IUPAC Name | 2-bromo-3-chloropropanal |
| SMILES | O=CC(Br)CCl |
| InChI | InChI=1S/C3H4BrClO/c4-3(1-5)2-6/h2-3H,1H2 |
| InChIKey | NORZIIJHTFHSOL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-chloropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-chloropropanal?
The IUPAC name of 2-bromo-3-chloropropanal (CID 12688066) is 2-bromo-3-chloropropanal.
What is the SMILES notation for 2-bromo-3-chloropropanal?
The canonical SMILES for 2-bromo-3-chloropropanal is O=CC(Br)CCl.
What is the InChIKey of 2-bromo-3-chloropropanal?
The InChIKey is NORZIIJHTFHSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4BrClO/c4-3(1-5)2-6/h2-3H,1H2.
What are the key properties of 2-bromo-3-chloropropanal?
2-bromo-3-chloropropanal has a molecular weight of 171.42 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-chloropropanal is sourced from PubChem (CID 12688066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).