About 3-ethylpent-4-enoic acid
3-ethylpent-4-enoic acid (PubChem CID 12688315) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-ethylpent-4-enoic acid.
Molecular Properties
| Compound Name | 3-ethylpent-4-enoic acid |
| PubChem CID | 12688315 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 3-ethylpent-4-enoic acid |
| SMILES | C=CC(CC)CC(=O)O |
| InChI | InChI=1S/C7H12O2/c1-3-6(4-2)5-7(8)9/h3,6H,1,4-5H2,2H3,(H,8,9) |
| InChIKey | UHLNDYACVPPMJT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpent-4-enoic acid?
The IUPAC name of 3-ethylpent-4-enoic acid (CID 12688315) is 3-ethylpent-4-enoic acid.
What is the SMILES notation for 3-ethylpent-4-enoic acid?
The canonical SMILES for 3-ethylpent-4-enoic acid is C=CC(CC)CC(=O)O.
What is the InChIKey of 3-ethylpent-4-enoic acid?
The InChIKey is UHLNDYACVPPMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-3-6(4-2)5-7(8)9/h3,6H,1,4-5H2,2H3,(H,8,9).
What are the key properties of 3-ethylpent-4-enoic acid?
3-ethylpent-4-enoic acid has a molecular weight of 128.17 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpent-4-enoic acid is sourced from PubChem (CID 12688315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).