About 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea
1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea (PubChem CID 1268838) has the molecular formula C16H15N3OS2
and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea |
| PubChem CID | 1268838 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea |
| SMILES | O=C1CS[C@@H](c2ccccc2)N1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H15N3OS2/c20-14-11-22-15(12-7-3-1-4-8-12)19(14)18-16(21)17-13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,17,18,21)/t15-/m0/s1 |
| InChIKey | GHTHLDCVGLNKDR-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea?
The IUPAC name of 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea (CID 1268838) is 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea.
What is the SMILES notation for 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea?
The canonical SMILES for 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea is O=C1CS[C@@H](c2ccccc2)N1NC(=S)Nc1ccccc1.
What is the InChIKey of 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea?
The InChIKey is GHTHLDCVGLNKDR-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H15N3OS2/c20-14-11-22-15(12-7-3-1-4-8-12)19(14)18-16(21)17-13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,17,18,21)/t15-/m0/s1.
What are the key properties of 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea?
1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea has a molecular weight of 329.45 g/mol, XLogP of 3.16, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]-3-phenylthiourea is sourced from PubChem (CID 1268838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).