About 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one
4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 12688567) has the molecular formula C22H20Cl2N2O3
and a molecular weight of 431.32 g/mol. Its IUPAC name is 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one |
| PubChem CID | 12688567 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | CCCC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(CCO)c1=O |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-2-3-18(28)20-19(14-4-8-16(23)9-5-14)21(15-6-10-17(24)11-7-15)25-26(12-13-27)22(20)29/h4-11,27H,2-3,12-13H2,1H3 |
| InChIKey | HBAMMAYBEIXSHK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one?
The IUPAC name of 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one (CID 12688567) is 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one.
What is the SMILES notation for 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one?
The canonical SMILES for 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one is CCCC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(CCO)c1=O.
What is the InChIKey of 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one?
The InChIKey is HBAMMAYBEIXSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N2O3/c1-2-3-18(28)20-19(14-4-8-16(23)9-5-14)21(15-6-10-17(24)11-7-15)25-26(12-13-27)22(20)29/h4-11,27H,2-3,12-13H2,1H3.
What are the key properties of 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one?
4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one has a molecular weight of 431.32 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butanoyl-5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one is sourced from PubChem (CID 12688567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).