About 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol
1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol (PubChem CID 12688725) has the molecular formula C9H21O4P
and a molecular weight of 224.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol |
| PubChem CID | 12688725 |
| Molecular Formula | C9H21O4P |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol |
| SMILES | CCOP(=O)(OCC)C(O)C(C)(C)C |
| InChI | InChI=1S/C9H21O4P/c1-6-12-14(11,13-7-2)8(10)9(3,4)5/h8,10H,6-7H2,1-5H3 |
| InChIKey | DFFSNLVLQQYIHX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol?
The IUPAC name of 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol (CID 12688725) is 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol?
The canonical SMILES for 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol is CCOP(=O)(OCC)C(O)C(C)(C)C.
What is the InChIKey of 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol?
The InChIKey is DFFSNLVLQQYIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O4P/c1-6-12-14(11,13-7-2)8(10)9(3,4)5/h8,10H,6-7H2,1-5H3.
What are the key properties of 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol?
1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol has a molecular weight of 224.24 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 12688725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).