C15H20N6O — CID 126887582
(2-methylpyrazol-3-yl)-[4-[(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methanone (PubChem CID 126887582) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-[4-[(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methanone.
| Compound Name | (2-methylpyrazol-3-yl)-[4-[(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126887582 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2-methylpyrazol-3-yl)-[4-[(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methanone |
| SMILES | Cc1cc(NC2CCN(C(=O)c3ccnn3C)CC2)ncn1 |
| InChI | InChI=1S/C15H20N6O/c1-11-9-14(17-10-16-11)19-12-4-7-21(8-5-12)15(22)13-3-6-18-20(13)2/h3,6,9-10,12H,4-5,7-8H2,1-2H3,(H,16,17,19) |
| InChIKey | PJGNBQLFSBSDTO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |