C6H16Cl2N7P3 — CID 12688883
15,15-dichloro-1,5,7,9,13,14,16-heptaza-6lambda5,8lambda5,15lambda5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene (PubChem CID 12688883) has the molecular formula C6H16Cl2N7P3 and a molecular weight of 350.07 g/mol. Its IUPAC name is 15,15-dichloro-1,5,7,9,13,14,16-heptaza-6lambda5,8lambda5,15lambda5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene.
| Compound Name | 15,15-dichloro-1,5,7,9,13,14,16-heptaza-6lambda5,8lambda5,15lambda5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
|---|---|
| PubChem CID | 12688883 |
| Molecular Formula | C6H16Cl2N7P3 |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 15,15-dichloro-1,5,7,9,13,14,16-heptaza-6lambda5,8lambda5,15lambda5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
| SMILES | ClP1(Cl)=NP2(=NP3(=N1)NCCCN3)NCCCN2 |
| InChI | InChI=1S/C6H16Cl2N7P3/c7-16(8)13-17(9-3-1-4-10-17)15-18(14-16)11-5-2-6-12-18/h9-12H,1-6H2 |
| InChIKey | NOUWBEUYUTXGRC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|