C18H24N6O — CID 126890517
3-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 126890517) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 126890517 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cc1cc(N(C2CC2)C2CCN(c3nccn(C)c3=O)CC2)ncn1 |
| InChI | InChI=1S/C18H24N6O/c1-13-11-16(21-12-20-13)24(14-3-4-14)15-5-8-23(9-6-15)17-18(25)22(2)10-7-19-17/h7,10-12,14-15H,3-6,8-9H2,1-2H3 |
| InChIKey | ACMIZVSJZWPYJI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |