About magnesium;2-methylbut-2-ene;bromide
magnesium;2-methylbut-2-ene;bromide (PubChem CID 12689470) has the molecular formula C5H9BrMg
and a molecular weight of 173.34 g/mol. Its IUPAC name is magnesium;2-methylbut-2-ene;bromide.
Molecular Properties
| Compound Name | magnesium;2-methylbut-2-ene;bromide |
| PubChem CID | 12689470 |
| Molecular Formula | C5H9BrMg |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | magnesium;2-methylbut-2-ene;bromide |
| SMILES | C[C-]=C(C)C.[Br-].[Mg+2] |
| InChI | InChI=1S/C5H9.BrH.Mg/c1-4-5(2)3;;/h1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | CEXMQGUYPBYVRM-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methylbut-2-ene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methylbut-2-ene;bromide?
The IUPAC name of magnesium;2-methylbut-2-ene;bromide (CID 12689470) is magnesium;2-methylbut-2-ene;bromide.
What is the SMILES notation for magnesium;2-methylbut-2-ene;bromide?
The canonical SMILES for magnesium;2-methylbut-2-ene;bromide is C[C-]=C(C)C.[Br-].[Mg+2].
What is the InChIKey of magnesium;2-methylbut-2-ene;bromide?
The InChIKey is CEXMQGUYPBYVRM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9.BrH.Mg/c1-4-5(2)3;;/h1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-methylbut-2-ene;bromide?
magnesium;2-methylbut-2-ene;bromide has a molecular weight of 173.34 g/mol, XLogP of -1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methylbut-2-ene;bromide is sourced from PubChem (CID 12689470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).