About 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline
6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline (PubChem CID 126894883) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline.
Molecular Properties
| Compound Name | 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline |
| PubChem CID | 126894883 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline |
| SMILES | COc1ncnc2ccc(N3CCN(CC4COCCO4)CC3)cc12 |
| InChI | InChI=1S/C18H24N4O3/c1-23-18-16-10-14(2-3-17(16)19-13-20-18)22-6-4-21(5-7-22)11-15-12-24-8-9-25-15/h2-3,10,13,15H,4-9,11-12H2,1H3 |
| InChIKey | DOVJDVHEBCQWMX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline?
The IUPAC name of 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline (CID 126894883) is 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline.
What is the SMILES notation for 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline?
The canonical SMILES for 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline is COc1ncnc2ccc(N3CCN(CC4COCCO4)CC3)cc12.
What is the InChIKey of 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline?
The InChIKey is DOVJDVHEBCQWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-23-18-16-10-14(2-3-17(16)19-13-20-18)22-6-4-21(5-7-22)11-15-12-24-8-9-25-15/h2-3,10,13,15H,4-9,11-12H2,1H3.
What are the key properties of 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline?
6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline has a molecular weight of 344.42 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-4-methoxyquinazoline is sourced from PubChem (CID 126894883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).