C21H26N6O — CID 126897440
7-[4-[(2-methylpyrimidin-5-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one (PubChem CID 126897440) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 7-[4-[(2-methylpyrimidin-5-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one.
| Compound Name | 7-[4-[(2-methylpyrimidin-5-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126897440 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 7-[4-[(2-methylpyrimidin-5-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
| SMILES | Cc1ncc(CN2CCN(c3ccc4c(=O)n(C(C)C)cnc4c3)CC2)cn1 |
| InChI | InChI=1S/C21H26N6O/c1-15(2)27-14-24-20-10-18(4-5-19(20)21(27)28)26-8-6-25(7-9-26)13-17-11-22-16(3)23-12-17/h4-5,10-12,14-15H,6-9,13H2,1-3H3 |
| InChIKey | DPABOIOGUDYZDW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |