C21H24N6O — CID 126897803
3-(cyclopropylmethyl)-7-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126897803) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-7-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(cyclopropylmethyl)-7-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126897803 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-(cyclopropylmethyl)-7-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one |
| SMILES | O=c1c2ccc(N3CCN(Cc4cccnn4)CC3)cc2ncn1CC1CC1 |
| InChI | InChI=1S/C21H24N6O/c28-21-19-6-5-18(12-20(19)22-15-27(21)13-16-3-4-16)26-10-8-25(9-11-26)14-17-2-1-7-23-24-17/h1-2,5-7,12,15-16H,3-4,8-11,13-14H2 |
| InChIKey | WHWNWJXWFOVARE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |