C12H14N2S — CID 12689837
3-butyl-4-phenyl-1,2,5-thiadiazole (PubChem CID 12689837) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 3-butyl-4-phenyl-1,2,5-thiadiazole.
| Compound Name | 3-butyl-4-phenyl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 12689837 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-butyl-4-phenyl-1,2,5-thiadiazole |
| SMILES | CCCCc1nsnc1-c1ccccc1 |
| InChI | InChI=1S/C12H14N2S/c1-2-3-9-11-12(14-15-13-11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | NLQNVTNLQRLWBK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |