C24H33N5O2 — CID 126898464
3-cyclopentyl-7-[4-[2-(2-oxopiperidin-1-yl)ethyl]piperazin-1-yl]quinazolin-4-one (PubChem CID 126898464) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-cyclopentyl-7-[4-[2-(2-oxopiperidin-1-yl)ethyl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-cyclopentyl-7-[4-[2-(2-oxopiperidin-1-yl)ethyl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898464 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 3-cyclopentyl-7-[4-[2-(2-oxopiperidin-1-yl)ethyl]piperazin-1-yl]quinazolin-4-one |
| SMILES | O=C1CCCCN1CCN1CCN(c2ccc3c(=O)n(C4CCCC4)cnc3c2)CC1 |
| InChI | InChI=1S/C24H33N5O2/c30-23-7-3-4-10-28(23)16-13-26-11-14-27(15-12-26)20-8-9-21-22(17-20)25-18-29(24(21)31)19-5-1-2-6-19/h8-9,17-19H,1-7,10-16H2 |
| InChIKey | ORVWGRIYPKDGLN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |