C13H8N4S — CID 12689849
10-phenyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 12689849) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 10-phenyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-phenyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 12689849 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 10-phenyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | c1ccc(-c2nnn3c2ncc2sccc23)cc1 |
| InChI | InChI=1S/C13H8N4S/c1-2-4-9(5-3-1)12-13-14-8-11-10(6-7-18-11)17(13)16-15-12/h1-8H |
| InChIKey | FZDSVTFZDAGIJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |