C15H15N3O3S — CID 12689900
8-methoxy-1,3-dimethyl-5-methylsulfanylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 12689900) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 8-methoxy-1,3-dimethyl-5-methylsulfanylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 8-methoxy-1,3-dimethyl-5-methylsulfanylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 12689900 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 8-methoxy-1,3-dimethyl-5-methylsulfanylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | COc1ccc2c(SC)c3c(=O)n(C)c(=O)n(C)c3nc2c1 |
| InChI | InChI=1S/C15H15N3O3S/c1-17-13-11(14(19)18(2)15(17)20)12(22-4)9-6-5-8(21-3)7-10(9)16-13/h5-7H,1-4H3 |
| InChIKey | XDMCNQLZAQXYRA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|