About 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine
7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine (PubChem CID 126900378) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine |
| PubChem CID | 126900378 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine |
| SMILES | c1cnn(C2CN(c3nncc4ccoc34)C2)c1 |
| InChI | InChI=1S/C12H11N5O/c1-3-14-17(4-1)10-7-16(8-10)12-11-9(2-5-18-11)6-13-15-12/h1-6,10H,7-8H2 |
| InChIKey | SCCAHOLUGPSQLM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine?
The IUPAC name of 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine (CID 126900378) is 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine.
What is the SMILES notation for 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine?
The canonical SMILES for 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine is c1cnn(C2CN(c3nncc4ccoc34)C2)c1.
What is the InChIKey of 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine?
The InChIKey is SCCAHOLUGPSQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c1-3-14-17(4-1)10-7-16(8-10)12-11-9(2-5-18-11)6-13-15-12/h1-6,10H,7-8H2.
What are the key properties of 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine?
7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine has a molecular weight of 241.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-pyrazol-1-ylazetidin-1-yl)furo[2,3-d]pyridazine is sourced from PubChem (CID 126900378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).