C21H17NO7 — CID 1269070
[(5aS,10bS)-5a,10b-diacetyloxy-6-oxo-5H-indeno[2,1-b]indol-3-yl] acetate (PubChem CID 1269070) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is [(5aS,10bS)-5a,10b-diacetyloxy-6-oxo-5H-indeno[2,1-b]indol-3-yl] acetate.
| Compound Name | [(5aS,10bS)-5a,10b-diacetyloxy-6-oxo-5H-indeno[2,1-b]indol-3-yl] acetate |
|---|---|
| PubChem CID | 1269070 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(5aS,10bS)-5a,10b-diacetyloxy-6-oxo-5H-indeno[2,1-b]indol-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)N[C@@]1(OC(C)=O)C(=O)c3ccccc3[C@]21OC(C)=O |
| InChI | InChI=1S/C21H17NO7/c1-11(23)27-14-8-9-17-18(10-14)22-21(29-13(3)25)19(26)15-6-4-5-7-16(15)20(17,21)28-12(2)24/h4-10,22H,1-3H3/t20-,21+/m0/s1 |
| InChIKey | NDBCQBAZFUAZEY-LEWJYISDSA-N |
| XLogP | 2.30 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|