About ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate
ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate (PubChem CID 12690848) has the molecular formula C9H9FN2O5
and a molecular weight of 244.18 g/mol. Its IUPAC name is ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate |
| PubChem CID | 12690848 |
| Molecular Formula | C9H9FN2O5 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate |
| SMILES | CCOC(=O)n1cc(F)c(=O)n(C(C)=O)c1=O |
| InChI | InChI=1S/C9H9FN2O5/c1-3-17-9(16)11-4-6(10)7(14)12(5(2)13)8(11)15/h4H,3H2,1-2H3 |
| InChIKey | WBKDKZNPDPUCOD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate?
The IUPAC name of ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate (CID 12690848) is ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate.
What is the SMILES notation for ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate?
The canonical SMILES for ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate is CCOC(=O)n1cc(F)c(=O)n(C(C)=O)c1=O.
What is the InChIKey of ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate?
The InChIKey is WBKDKZNPDPUCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O5/c1-3-17-9(16)11-4-6(10)7(14)12(5(2)13)8(11)15/h4H,3H2,1-2H3.
What are the key properties of ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate?
ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate has a molecular weight of 244.18 g/mol, XLogP of -0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetyl-5-fluoro-2,4-dioxopyrimidine-1-carboxylate is sourced from PubChem (CID 12690848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).