About (2E)-3,4-dimethylpenta-2,4-dienenitrile
(2E)-3,4-dimethylpenta-2,4-dienenitrile (PubChem CID 12691049) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is (2E)-3,4-dimethylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-3,4-dimethylpenta-2,4-dienenitrile |
| PubChem CID | 12691049 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | (2E)-3,4-dimethylpenta-2,4-dienenitrile |
| SMILES | C=C(C)/C(C)=C/C#N |
| InChI | InChI=1S/C7H9N/c1-6(2)7(3)4-5-8/h4H,1H2,2-3H3/b7-4+ |
| InChIKey | OGVOGOXVFDVZEC-QPJJXVBHSA-N |
| XLogP | 2.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,4-dimethylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,4-dimethylpenta-2,4-dienenitrile?
The IUPAC name of (2E)-3,4-dimethylpenta-2,4-dienenitrile (CID 12691049) is (2E)-3,4-dimethylpenta-2,4-dienenitrile.
What is the SMILES notation for (2E)-3,4-dimethylpenta-2,4-dienenitrile?
The canonical SMILES for (2E)-3,4-dimethylpenta-2,4-dienenitrile is C=C(C)/C(C)=C/C#N.
What is the InChIKey of (2E)-3,4-dimethylpenta-2,4-dienenitrile?
The InChIKey is OGVOGOXVFDVZEC-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H9N/c1-6(2)7(3)4-5-8/h4H,1H2,2-3H3/b7-4+.
What are the key properties of (2E)-3,4-dimethylpenta-2,4-dienenitrile?
(2E)-3,4-dimethylpenta-2,4-dienenitrile has a molecular weight of 107.16 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,4-dimethylpenta-2,4-dienenitrile is sourced from PubChem (CID 12691049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).