C21H27N9O — CID 126910816
6-tert-butyl-3-[1-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 126910816) has the molecular formula C21H27N9O and a molecular weight of 421.51 g/mol. Its IUPAC name is 6-tert-butyl-3-[1-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-tert-butyl-3-[1-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 126910816 |
| Molecular Formula | C21H27N9O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 6-tert-butyl-3-[1-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COCc1cc(N2CCC(c3nnc4ccc(C(C)(C)C)nn34)CC2)n2ncnc2n1 |
| InChI | InChI=1S/C21H27N9O/c1-21(2,3)16-5-6-17-25-26-19(29(17)27-16)14-7-9-28(10-8-14)18-11-15(12-31-4)24-20-22-13-23-30(18)20/h5-6,11,13-14H,7-10,12H2,1-4H3 |
| InChIKey | MNYNYBWPROMOQW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |