C20H27N7O — CID 126911815
6-methoxy-3-[1-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 126911815) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-methoxy-3-[1-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-methoxy-3-[1-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 126911815 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 6-methoxy-3-[1-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COc1ccc2nnc(C3CCN(Cc4c5c(nn4C)CCCC5)CC3)n2n1 |
| InChI | InChI=1S/C20H27N7O/c1-25-17(15-5-3-4-6-16(15)23-25)13-26-11-9-14(10-12-26)20-22-21-18-7-8-19(28-2)24-27(18)20/h7-8,14H,3-6,9-13H2,1-2H3 |
| InChIKey | ZRALOUKFKUQPDX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |