C17H27N7O2S — CID 126912151
3-[1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]piperidin-4-yl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 126912151) has the molecular formula C17H27N7O2S and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-[1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]piperidin-4-yl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-[1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]piperidin-4-yl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 126912151 |
| Molecular Formula | C17H27N7O2S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-[1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]piperidin-4-yl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CN(C)c1ccc2nnc(C3CCN(CCN4CCCS4(=O)=O)CC3)n2n1 |
| InChI | InChI=1S/C17H27N7O2S/c1-21(2)16-5-4-15-18-19-17(24(15)20-16)14-6-9-22(10-7-14)11-12-23-8-3-13-27(23,25)26/h4-5,14H,3,6-13H2,1-2H3 |
| InChIKey | CIRUUSMNUBPIFN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 86.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |