About 3-oxononyl formate
3-oxononyl formate (PubChem CID 12691618) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-oxononyl formate.
Molecular Properties
| Compound Name | 3-oxononyl formate |
| PubChem CID | 12691618 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 3-oxononyl formate |
| SMILES | CCCCCCC(=O)CCOC=O |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-10(12)7-8-13-9-11/h9H,2-8H2,1H3 |
| InChIKey | YMCCASKAZOESMW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-oxononyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxononyl formate?
The IUPAC name of 3-oxononyl formate (CID 12691618) is 3-oxononyl formate.
What is the SMILES notation for 3-oxononyl formate?
The canonical SMILES for 3-oxononyl formate is CCCCCCC(=O)CCOC=O.
What is the InChIKey of 3-oxononyl formate?
The InChIKey is YMCCASKAZOESMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-2-3-4-5-6-10(12)7-8-13-9-11/h9H,2-8H2,1H3.
What are the key properties of 3-oxononyl formate?
3-oxononyl formate has a molecular weight of 186.25 g/mol, XLogP of 2.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxononyl formate is sourced from PubChem (CID 12691618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).