5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid

C9H10O3 — CID 12691643

IUPAC5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid
SMILESO=C1C=C2CCCC2(C(=O)O)C1
InChIInChI=1S/C9H10O3/c10-7-4-6-2-1-3-9(6,5-7)8(11)12/h4H,1-3,5H2,(H,11,12)
InChIKeyMCONDQGROJZIEJ-UHFFFAOYSA-N
MW166.18 g/mol
LogP1.14
Rot. Bonds1

About 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid

5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid (PubChem CID 12691643) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid.

Molecular Properties

Compound Name5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid
PubChem CID12691643
Molecular FormulaC9H10O3
Molecular Weight166.18 g/mol
Exact Mass166.06
IUPAC Name5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid
SMILESO=C1C=C2CCCC2(C(=O)O)C1
InChIInChI=1S/C9H10O3/c10-7-4-6-2-1-3-9(6,5-7)8(11)12/h4H,1-3,5H2,(H,11,12)
InChIKeyMCONDQGROJZIEJ-UHFFFAOYSA-N
XLogP1.14
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid?
The IUPAC name of 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid (CID 12691643) is 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid.
What is the SMILES notation for 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid?
The canonical SMILES for 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid is O=C1C=C2CCCC2(C(=O)O)C1.
What is the InChIKey of 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid?
The InChIKey is MCONDQGROJZIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-7-4-6-2-1-3-9(6,5-7)8(11)12/h4H,1-3,5H2,(H,11,12).
What are the key properties of 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid?
5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,2,3,4-tetrahydropentalene-3a-carboxylic acid is sourced from PubChem (CID 12691643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).