About 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine
2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 126916736) has the molecular formula C16H19N7
and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 126916736 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1ccc(N2CC(CNc3nccn4nc(C)cc34)C2)nn1 |
| InChI | InChI=1S/C16H19N7/c1-11-3-4-15(20-19-11)22-9-13(10-22)8-18-16-14-7-12(2)21-23(14)6-5-17-16/h3-7,13H,8-10H2,1-2H3,(H,17,18) |
| InChIKey | FEYMNFVOBJXDPP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine (CID 126916736) is 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine is Cc1ccc(N2CC(CNc3nccn4nc(C)cc34)C2)nn1.
What is the InChIKey of 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is FEYMNFVOBJXDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N7/c1-11-3-4-15(20-19-11)22-9-13(10-22)8-18-16-14-7-12(2)21-23(14)6-5-17-16/h3-7,13H,8-10H2,1-2H3,(H,17,18).
What are the key properties of 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine?
2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 309.38 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[[1-(6-methylpyridazin-3-yl)azetidin-3-yl]methyl]pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 126916736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).