About 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine
4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine (PubChem CID 12691719) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine.
Molecular Properties
| Compound Name | 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
| PubChem CID | 12691719 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
| SMILES | c1ccc2c(c1)COCc1cccn1-2 |
| InChI | InChI=1S/C12H11NO/c1-2-6-12-10(4-1)8-14-9-11-5-3-7-13(11)12/h1-7H,8-9H2 |
| InChIKey | WXFKUMYQEAUETC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine?
The IUPAC name of 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine (CID 12691719) is 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine.
What is the SMILES notation for 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine?
The canonical SMILES for 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine is c1ccc2c(c1)COCc1cccn1-2.
What is the InChIKey of 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine?
The InChIKey is WXFKUMYQEAUETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-2-6-12-10(4-1)8-14-9-11-5-3-7-13(11)12/h1-7H,8-9H2.
What are the key properties of 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine?
4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine has a molecular weight of 185.23 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine is sourced from PubChem (CID 12691719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).