C18H23N5O — CID 126917477
1-[2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]-methylamino]ethyl]pyridin-2-one (PubChem CID 126917477) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]-methylamino]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]-methylamino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 126917477 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-[2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]-methylamino]ethyl]pyridin-2-one |
| SMILES | CN(CCn1ccccc1=O)C1CN(c2ccc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C18H23N5O/c1-21(10-11-22-9-3-2-4-18(22)24)15-12-23(13-15)17-8-7-16(19-20-17)14-5-6-14/h2-4,7-9,14-15H,5-6,10-13H2,1H3 |
| InChIKey | XIZSYUQKNHCVPU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |