C19H21N5O2S — CID 126919633
N-methyl-1,1-dioxo-N-[1-(5,6,7,8-tetrahydrocinnolin-3-yl)azetidin-3-yl]-1,2-benzothiazol-3-amine (PubChem CID 126919633) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-[1-(5,6,7,8-tetrahydrocinnolin-3-yl)azetidin-3-yl]-1,2-benzothiazol-3-amine.
| Compound Name | N-methyl-1,1-dioxo-N-[1-(5,6,7,8-tetrahydrocinnolin-3-yl)azetidin-3-yl]-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 126919633 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-methyl-1,1-dioxo-N-[1-(5,6,7,8-tetrahydrocinnolin-3-yl)azetidin-3-yl]-1,2-benzothiazol-3-amine |
| SMILES | CN(C1=NS(=O)(=O)c2ccccc21)C1CN(c2cc3c(nn2)CCCC3)C1 |
| InChI | InChI=1S/C19H21N5O2S/c1-23(19-15-7-3-5-9-17(15)27(25,26)22-19)14-11-24(12-14)18-10-13-6-2-4-8-16(13)20-21-18/h3,5,7,9-10,14H,2,4,6,8,11-12H2,1H3 |
| InChIKey | ORDRBJWYMGHARG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |