C18H22N8OS — CID 126921178
1-methyl-1-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea (PubChem CID 126921178) has the molecular formula C18H22N8OS and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-methyl-1-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-methyl-1-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 126921178 |
| Molecular Formula | C18H22N8OS |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-methyl-1-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
| SMILES | Cc1nnc2ccc(N3CC(N(C)C(=O)Nc4nc5c(s4)CCCC5)C3)nn12 |
| InChI | InChI=1S/C18H22N8OS/c1-11-21-22-15-7-8-16(23-26(11)15)25-9-12(10-25)24(2)18(27)20-17-19-13-5-3-4-6-14(13)28-17/h7-8,12H,3-6,9-10H2,1-2H3,(H,19,20,27) |
| InChIKey | PIBZEKOBMJBETG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |