C16H34O3Si — CID 12692196
(3S,5S,6S)-6-hydroxy-2,2,5,7,7-pentamethyl-3-trimethylsilyloxyoctan-4-one (PubChem CID 12692196) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (3S,5S,6S)-6-hydroxy-2,2,5,7,7-pentamethyl-3-trimethylsilyloxyoctan-4-one.
| Compound Name | (3S,5S,6S)-6-hydroxy-2,2,5,7,7-pentamethyl-3-trimethylsilyloxyoctan-4-one |
|---|---|
| PubChem CID | 12692196 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (3S,5S,6S)-6-hydroxy-2,2,5,7,7-pentamethyl-3-trimethylsilyloxyoctan-4-one |
| SMILES | C[C@H](C(=O)[C@@H](O[Si](C)(C)C)C(C)(C)C)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-11(13(18)15(2,3)4)12(17)14(16(5,6)7)19-20(8,9)10/h11,13-14,18H,1-10H3/t11-,13+,14-/m1/s1 |
| InChIKey | IUKLNSKAWZCKDV-KWCYVHTRSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|