C16H20N8S — CID 126922204
N-[1-(3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-N,5-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 126922204) has the molecular formula C16H20N8S and a molecular weight of 356.46 g/mol. Its IUPAC name is N-[1-(3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-N,5-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-(3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 126922204 |
| Molecular Formula | C16H20N8S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[1-(3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(N(C)C2CN(c3ccc4nnc(C5CCC5)n4n3)C2)s1 |
| InChI | InChI=1S/C16H20N8S/c1-10-17-20-16(25-10)22(2)12-8-23(9-12)14-7-6-13-18-19-15(24(13)21-14)11-4-3-5-11/h6-7,11-12H,3-5,8-9H2,1-2H3 |
| InChIKey | KKAWJHLWNJDMTH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |