C21H27N7O2 — CID 126922397
N-[[1-(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 126922397) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[[1-(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | N-[[1-(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 126922397 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[[1-(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | CC(C)(C)c1nnc2ccc(N3CC(CNC(=O)c4noc5c4CCCC5)C3)nn12 |
| InChI | InChI=1S/C21H27N7O2/c1-21(2,3)20-24-23-16-8-9-17(25-28(16)20)27-11-13(12-27)10-22-19(29)18-14-6-4-5-7-15(14)30-26-18/h8-9,13H,4-7,10-12H2,1-3H3,(H,22,29) |
| InChIKey | SYCDQAFYGQKKCD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |