C15H22N4O3 — CID 126923305
4-[2-[2-[(6-oxopyridazin-1-yl)methyl]pyrrolidin-1-yl]ethyl]morpholin-3-one (PubChem CID 126923305) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-[2-[2-[(6-oxopyridazin-1-yl)methyl]pyrrolidin-1-yl]ethyl]morpholin-3-one.
| Compound Name | 4-[2-[2-[(6-oxopyridazin-1-yl)methyl]pyrrolidin-1-yl]ethyl]morpholin-3-one |
|---|---|
| PubChem CID | 126923305 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-[2-[2-[(6-oxopyridazin-1-yl)methyl]pyrrolidin-1-yl]ethyl]morpholin-3-one |
| SMILES | O=C1COCCN1CCN1CCCC1Cn1ncccc1=O |
| InChI | InChI=1S/C15H22N4O3/c20-14-4-1-5-16-19(14)11-13-3-2-6-17(13)7-8-18-9-10-22-12-15(18)21/h1,4-5,13H,2-3,6-12H2 |
| InChIKey | RGOQWRTZMNROCI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |