C18H22BrN3O2S — CID 126924183
2-[[1-(4-bromothiophene-2-carbonyl)pyrrolidin-2-yl]methyl]-6-tert-butylpyridazin-3-one (PubChem CID 126924183) has the molecular formula C18H22BrN3O2S and a molecular weight of 424.36 g/mol. Its IUPAC name is 2-[[1-(4-bromothiophene-2-carbonyl)pyrrolidin-2-yl]methyl]-6-tert-butylpyridazin-3-one.
| Compound Name | 2-[[1-(4-bromothiophene-2-carbonyl)pyrrolidin-2-yl]methyl]-6-tert-butylpyridazin-3-one |
|---|---|
| PubChem CID | 126924183 |
| Molecular Formula | C18H22BrN3O2S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-[[1-(4-bromothiophene-2-carbonyl)pyrrolidin-2-yl]methyl]-6-tert-butylpyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CCCN2C(=O)c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C18H22BrN3O2S/c1-18(2,3)15-6-7-16(23)22(20-15)10-13-5-4-8-21(13)17(24)14-9-12(19)11-25-14/h6-7,9,11,13H,4-5,8,10H2,1-3H3 |
| InChIKey | VJPOJUHBTZMENB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |