C21H20N8O2 — CID 126926376
6-imidazol-1-yl-2-[[1-(2-phenyltriazole-4-carbonyl)pyrrolidin-2-yl]methyl]pyridazin-3-one (PubChem CID 126926376) has the molecular formula C21H20N8O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 6-imidazol-1-yl-2-[[1-(2-phenyltriazole-4-carbonyl)pyrrolidin-2-yl]methyl]pyridazin-3-one.
| Compound Name | 6-imidazol-1-yl-2-[[1-(2-phenyltriazole-4-carbonyl)pyrrolidin-2-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126926376 |
| Molecular Formula | C21H20N8O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 6-imidazol-1-yl-2-[[1-(2-phenyltriazole-4-carbonyl)pyrrolidin-2-yl]methyl]pyridazin-3-one |
| SMILES | O=C(c1cnn(-c2ccccc2)n1)N1CCCC1Cn1nc(-n2ccnc2)ccc1=O |
| InChI | InChI=1S/C21H20N8O2/c30-20-9-8-19(26-12-10-22-15-26)25-28(20)14-17-7-4-11-27(17)21(31)18-13-23-29(24-18)16-5-2-1-3-6-16/h1-3,5-6,8-10,12-13,15,17H,4,7,11,14H2 |
| InChIKey | HNAULFFTCYFNHS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |