C6H7N3O3 — CID 12692638
1-methyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 12692638) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 1-methyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | 1-methyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 12692638 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 1-methyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1cc(C(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7N3O3/c1-9-2-3(4(7)10)5(11)8-6(9)12/h2H,1H3,(H2,7,10)(H,8,11,12) |
| InChIKey | HKELWXCXPBFGRR-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |