C16H19N5O — CID 126927153
2-[[1-(3-cyclopropylpyrazin-2-yl)azetidin-3-yl]methyl]-6-methylpyridazin-3-one (PubChem CID 126927153) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[[1-(3-cyclopropylpyrazin-2-yl)azetidin-3-yl]methyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[[1-(3-cyclopropylpyrazin-2-yl)azetidin-3-yl]methyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126927153 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[[1-(3-cyclopropylpyrazin-2-yl)azetidin-3-yl]methyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC2CN(c3nccnc3C3CC3)C2)n1 |
| InChI | InChI=1S/C16H19N5O/c1-11-2-5-14(22)21(19-11)10-12-8-20(9-12)16-15(13-3-4-13)17-6-7-18-16/h2,5-7,12-13H,3-4,8-10H2,1H3 |
| InChIKey | MTLHQISFUYAXBT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |