C18H21N5O — CID 126927367
6-cyclopropyl-2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methyl]pyridazin-3-one (PubChem CID 126927367) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-cyclopropyl-2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methyl]pyridazin-3-one.
| Compound Name | 6-cyclopropyl-2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126927367 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-cyclopropyl-2-[[1-(6-cyclopropylpyridazin-3-yl)azetidin-3-yl]methyl]pyridazin-3-one |
| SMILES | O=c1ccc(C2CC2)nn1CC1CN(c2ccc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C18H21N5O/c24-18-8-6-16(14-3-4-14)21-23(18)11-12-9-22(10-12)17-7-5-15(19-20-17)13-1-2-13/h5-8,12-14H,1-4,9-11H2 |
| InChIKey | HAESGGJSVXYCRB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |