C18H21N5O — CID 126927727
6-[3-[(3-tert-butyl-6-oxopyridazin-1-yl)methyl]azetidin-1-yl]pyridine-3-carbonitrile (PubChem CID 126927727) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-[3-[(3-tert-butyl-6-oxopyridazin-1-yl)methyl]azetidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[3-[(3-tert-butyl-6-oxopyridazin-1-yl)methyl]azetidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 126927727 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-[3-[(3-tert-butyl-6-oxopyridazin-1-yl)methyl]azetidin-1-yl]pyridine-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CN(c3ccc(C#N)cn3)C2)n1 |
| InChI | InChI=1S/C18H21N5O/c1-18(2,3)15-5-7-17(24)23(21-15)12-14-10-22(11-14)16-6-4-13(8-19)9-20-16/h4-7,9,14H,10-12H2,1-3H3 |
| InChIKey | CYKJLCAADDXOEX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |