About bis(prop-2-enyl) sulfite
bis(prop-2-enyl) sulfite (PubChem CID 12692803) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is bis(prop-2-enyl) sulfite.
Molecular Properties
| Compound Name | bis(prop-2-enyl) sulfite |
| PubChem CID | 12692803 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | bis(prop-2-enyl) sulfite |
| SMILES | C=CCOS(=O)OCC=C |
| InChI | InChI=1S/C6H10O3S/c1-3-5-8-10(7)9-6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | YVECZSPKOWOZPN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) sulfite?
The IUPAC name of bis(prop-2-enyl) sulfite (CID 12692803) is bis(prop-2-enyl) sulfite.
What is the SMILES notation for bis(prop-2-enyl) sulfite?
The canonical SMILES for bis(prop-2-enyl) sulfite is C=CCOS(=O)OCC=C.
What is the InChIKey of bis(prop-2-enyl) sulfite?
The InChIKey is YVECZSPKOWOZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c1-3-5-8-10(7)9-6-4-2/h3-4H,1-2,5-6H2.
What are the key properties of bis(prop-2-enyl) sulfite?
bis(prop-2-enyl) sulfite has a molecular weight of 162.21 g/mol, XLogP of 0.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) sulfite is sourced from PubChem (CID 12692803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).