About 3-chlorobut-3-en-2-one
3-chlorobut-3-en-2-one (PubChem CID 12693) has the molecular formula C4H5ClO
and a molecular weight of 104.54 g/mol. Its IUPAC name is 3-chlorobut-3-en-2-one.
Molecular Properties
| Compound Name | 3-chlorobut-3-en-2-one |
| PubChem CID | 12693 |
| Molecular Formula | C4H5ClO |
| Molecular Weight | 104.54 g/mol |
| Exact Mass | 104.00 |
| IUPAC Name | 3-chlorobut-3-en-2-one |
| SMILES | C=C(Cl)C(C)=O |
| InChI | InChI=1S/C4H5ClO/c1-3(5)4(2)6/h1H2,2H3 |
| InChIKey | AUITUKWCKGNHMQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobut-3-en-2-one?
The IUPAC name of 3-chlorobut-3-en-2-one (CID 12693) is 3-chlorobut-3-en-2-one.
What is the SMILES notation for 3-chlorobut-3-en-2-one?
The canonical SMILES for 3-chlorobut-3-en-2-one is C=C(Cl)C(C)=O.
What is the InChIKey of 3-chlorobut-3-en-2-one?
The InChIKey is AUITUKWCKGNHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO/c1-3(5)4(2)6/h1H2,2H3.
What are the key properties of 3-chlorobut-3-en-2-one?
3-chlorobut-3-en-2-one has a molecular weight of 104.54 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobut-3-en-2-one is sourced from PubChem (CID 12693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).