C22H29FN4O2 — CID 126930953
2-[(3-fluorophenyl)methyl]-6-[2-[(oxan-4-ylamino)methyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 126930953) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-6-[2-[(oxan-4-ylamino)methyl]piperidin-1-yl]pyridazin-3-one.
| Compound Name | 2-[(3-fluorophenyl)methyl]-6-[2-[(oxan-4-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126930953 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-6-[2-[(oxan-4-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | O=c1ccc(N2CCCCC2CNC2CCOCC2)nn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H29FN4O2/c23-18-5-3-4-17(14-18)16-27-22(28)8-7-21(25-27)26-11-2-1-6-20(26)15-24-19-9-12-29-13-10-19/h3-5,7-8,14,19-20,24H,1-2,6,9-13,15-16H2 |
| InChIKey | OWGVLSSJUBTQEG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |