C18H24N8O — CID 126931091
2-propan-2-yl-6-[2-[(7H-purin-6-ylamino)methyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 126931091) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-propan-2-yl-6-[2-[(7H-purin-6-ylamino)methyl]piperidin-1-yl]pyridazin-3-one.
| Compound Name | 2-propan-2-yl-6-[2-[(7H-purin-6-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126931091 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-propan-2-yl-6-[2-[(7H-purin-6-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | CC(C)n1nc(N2CCCCC2CNc2ncnc3nc[nH]c23)ccc1=O |
| InChI | InChI=1S/C18H24N8O/c1-12(2)26-15(27)7-6-14(24-26)25-8-4-3-5-13(25)9-19-17-16-18(21-10-20-16)23-11-22-17/h6-7,10-13H,3-5,8-9H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | VLIYNDJITMAUCU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |