C22H32N4O3 — CID 126931518
N-[[1-[1-(2-hydroxycyclohexyl)-6-oxopyridazin-3-yl]piperidin-2-yl]methyl]cyclopent-3-ene-1-carboxamide (PubChem CID 126931518) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[[1-[1-(2-hydroxycyclohexyl)-6-oxopyridazin-3-yl]piperidin-2-yl]methyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[[1-[1-(2-hydroxycyclohexyl)-6-oxopyridazin-3-yl]piperidin-2-yl]methyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 126931518 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[[1-[1-(2-hydroxycyclohexyl)-6-oxopyridazin-3-yl]piperidin-2-yl]methyl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NCC1CCCCN1c1ccc(=O)n(C2CCCCC2O)n1)C1CC=CC1 |
| InChI | InChI=1S/C22H32N4O3/c27-19-11-4-3-10-18(19)26-21(28)13-12-20(24-26)25-14-6-5-9-17(25)15-23-22(29)16-7-1-2-8-16/h1-2,12-13,16-19,27H,3-11,14-15H2,(H,23,29) |
| InChIKey | DDXGAOSKPOCTDU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|