C14H18N6S — CID 126931726
3-methyl-5-[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,2,4-thiadiazole (PubChem CID 126931726) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is 3-methyl-5-[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,2,4-thiadiazole.
| Compound Name | 3-methyl-5-[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 126931726 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-methyl-5-[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,2,4-thiadiazole |
| SMILES | Cc1cc(N2CC3CN(c4nc(C)ns4)CC3C2)ncn1 |
| InChI | InChI=1S/C14H18N6S/c1-9-3-13(16-8-15-9)19-4-11-6-20(7-12(11)5-19)14-17-10(2)18-21-14/h3,8,11-12H,4-7H2,1-2H3 |
| InChIKey | AJFDHYMOMSIDHR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |