C18H23FN6 — CID 126932574
2-(6-tert-butylpyrimidin-4-yl)-5-(5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126932574) has the molecular formula C18H23FN6 and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(6-tert-butylpyrimidin-4-yl)-5-(5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-(6-tert-butylpyrimidin-4-yl)-5-(5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126932574 |
| Molecular Formula | C18H23FN6 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-(6-tert-butylpyrimidin-4-yl)-5-(5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)c1cc(N2CC3CN(c4ncncc4F)CC3C2)ncn1 |
| InChI | InChI=1S/C18H23FN6/c1-18(2,3)15-4-16(22-11-21-15)24-6-12-8-25(9-13(12)7-24)17-14(19)5-20-10-23-17/h4-5,10-13H,6-9H2,1-3H3 |
| InChIKey | RVOHOGUCDXVUAQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |