C18H19F3N6 — CID 126932690
2-(6-cyclopropylpyrimidin-4-yl)-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126932690) has the molecular formula C18H19F3N6 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(6-cyclopropylpyrimidin-4-yl)-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-(6-cyclopropylpyrimidin-4-yl)-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126932690 |
| Molecular Formula | C18H19F3N6 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(6-cyclopropylpyrimidin-4-yl)-5-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | FC(F)(F)c1ccnc(N2CC3CN(c4cc(C5CC5)ncn4)CC3C2)n1 |
| InChI | InChI=1S/C18H19F3N6/c19-18(20,21)15-3-4-22-17(25-15)27-8-12-6-26(7-13(12)9-27)16-5-14(11-1-2-11)23-10-24-16/h3-5,10-13H,1-2,6-9H2 |
| InChIKey | ZHLIEHGODGIYMS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |