C17H19F3N6O — CID 126932729
2-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-(trifluoromethyl)-1,3,4-oxadiazole (PubChem CID 126932729) has the molecular formula C17H19F3N6O and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-(trifluoromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-(trifluoromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 126932729 |
| Molecular Formula | C17H19F3N6O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-(trifluoromethyl)-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1nnc(CN2CC3CN(c4cc(C5CC5)ncn4)CC3C2)o1 |
| InChI | InChI=1S/C17H19F3N6O/c18-17(19,20)16-24-23-15(27-16)8-25-4-11-6-26(7-12(11)5-25)14-3-13(10-1-2-10)21-9-22-14/h3,9-12H,1-2,4-8H2 |
| InChIKey | GVJOGQOQLMRZRM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |