C18H23N5S — CID 126932774
5-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 126932774) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 126932774 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-[[5-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CN2CC3CN(c4cc(C5CC5)ncn4)CC3C2)s1 |
| InChI | InChI=1S/C18H23N5S/c1-12-19-5-16(24-12)10-22-6-14-8-23(9-15(14)7-22)18-4-17(13-2-3-13)20-11-21-18/h4-5,11,13-15H,2-3,6-10H2,1H3 |
| InChIKey | SGAMXCLFWCZJNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |